CAS 90133-35-0 appears in our catalog under these names: 4-Methyl-2-(phenylsulfanyl)benzonitrile, 98%, 4-Methyl-2-(phenylsulfanyl)benzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-methyl-2-phenylsulfanylbenzonitrile (CAS 90133-35-0) is a chemical compound with the molecular formula C14H11NS and a molecular weight of 225.31 g/mol. IUPAC name: 4-methyl-2-phenylsulfanylbenzonitrile. InChIKey: ISPCPKAHVMDZMO-UHFFFAOYSA-N.
| Molecular formula | C14H11NS |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | 4-methyl-2-phenylsulfanylbenzonitrile |
| InChIKey | ISPCPKAHVMDZMO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C#N)SC2=CC=CC=C2 |
Computed by PubChem (NCBI)