Products 107611-15-4

CAS 107611-15-4 is the registry number for 5-Methyl-2-phenyl-1,3-benzothiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

5-methyl-2-phenyl-1,3-benzothiazole (CAS 107611-15-4) is a chemical compound with the molecular formula C14H11NS and a molecular weight of 225.31 g/mol. IUPAC name: 5-methyl-2-phenyl-1,3-benzothiazole. InChIKey: CIRWUZNDHHSHSU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11NS
Molecular weight225.31 g/mol
IUPAC name5-methyl-2-phenyl-1,3-benzothiazole
InChIKeyCIRWUZNDHHSHSU-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)SC(=N2)C3=CC=CC=C3

Computed by PubChem (NCBI)