BenzilDioxime, 98%, 98%
cas: 23873-81-6 — see every product listed under this CAS number, including other names
BenzilDioxime, 98%, 98% (CAS 23873-81-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PPM-5g |
| cas | 23873-81-6 |
| size | 5g |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 100g | 318.80 Pln | |
| Chemat | 500g | 1204.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine (CAS 23873-81-6) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine. InChIKey: JJZONEUCDUQVGR-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine |
| InChIKey | JJZONEUCDUQVGR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=NO)C(=NO)C2=CC=CC=C2 |
Computed by PubChem (NCBI)