cas: 3529-57-5 — see every product listed under this CAS number, including other names
Benzo[c][1,2,5]thiadiazole-4-carboxylic acid 95+% (CAS 3529-57-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A235057-250mg |
| cas | 3529-57-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1154.69 Pln | |
| Ambeed | 5g | 3424.19 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A235057 |
2,1,3-benzothiadiazole-4-carboxylic acid (CAS 3529-57-5) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: 2,1,3-benzothiadiazole-4-carboxylic acid. InChIKey: ZGDGZMOKXTUMEV-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | 2,1,3-benzothiadiazole-4-carboxylic acid |
| InChIKey | ZGDGZMOKXTUMEV-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)