cas: 3529-57-5 — see every product listed under this CAS number, including other names
2,1,3-Benzothiadiazole-4-carboxylic acid, 97% (CAS 3529-57-5) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC09101CB |
| cas | 3529-57-5 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 615.99 Pln | |
| Thermo Scientific | 1g | 1776.69 Pln | |
| Thermo Scientific | 5g | 4255.91 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2,1,3-benzothiadiazole-4-carboxylic acid (CAS 3529-57-5) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: 2,1,3-benzothiadiazole-4-carboxylic acid. InChIKey: ZGDGZMOKXTUMEV-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | 2,1,3-benzothiadiazole-4-carboxylic acid |
| InChIKey | ZGDGZMOKXTUMEV-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)