cas: 4847-94-3 — see every product listed under this CAS number, including other names
Benzo[d][1,3]dioxole-5-carboxamide, 95%, 95% (CAS 4847-94-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 250g, 500g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DC7P-25g |
| cas | 4847-94-3 |
| size | 25g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 3290.00 Pln | |
| Chemat | 50g | 6520.40 Pln | |
| Chemat | 100g | 12813.20 Pln | |
| Chemat | 250g | 31768.40 Pln | |
| Chemat | 500g | 62164.80 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 362.00 Pln | |
| Chemat | 5g | 1048.40 Pln | |
| Chemat | 10g | 1677.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3-benzodioxole-5-carboxamide (CAS 4847-94-3) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 1,3-benzodioxole-5-carboxamide. InChIKey: HUSYTLMIRXITQS-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 1,3-benzodioxole-5-carboxamide |
| InChIKey | HUSYTLMIRXITQS-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)