CAS 4847-94-3 appears in our catalog under these names: 1,3-Benzodioxole-5-carboxamide, 95%, 1,3-Benzodioxole-5-carboxamide, Benzo[d][1,3]dioxole-5-carboxamide 95%, Benzo[d][1,3]dioxole-5-carboxamide, 95%, 95%, Benzo[d][1,3]dioxole-5-carboxamide, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g, 100mg, 25g, 50g.
1,3-benzodioxole-5-carboxamide (CAS 4847-94-3) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 1,3-benzodioxole-5-carboxamide. InChIKey: HUSYTLMIRXITQS-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 1,3-benzodioxole-5-carboxamide |
| InChIKey | HUSYTLMIRXITQS-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)