cas: 606-26-8 — see every product listed under this CAS number, including other names
Benzoic acid, 2-nitro-, hydrazide, 98%, 98% (CAS 606-26-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HSF-10g |
| cas | 606-26-8 |
| size | 10g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 218.00 Pln | |
| Chemat | 50g | 606.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 25g | 357.20 Pln | |
| Chemat | 100g | 1062.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-nitrobenzohydrazide (CAS 606-26-8) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 2-nitrobenzohydrazide. InChIKey: LYGGDXLOJMNFBV-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 2-nitrobenzohydrazide |
| InChIKey | LYGGDXLOJMNFBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)