CAS 1261676-58-7 appears in our catalog under these names: 2-Amino-6-nitrobenzamide, 95%, 2-Amino-6-nitrobenzamide, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-amino-6-nitrobenzamide (CAS 1261676-58-7) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 2-amino-6-nitrobenzamide. InChIKey: VSBVFLVLPDTKPJ-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 2-amino-6-nitrobenzamide |
| InChIKey | VSBVFLVLPDTKPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)N)N |
Computed by PubChem (NCBI)