CAS 2273-04-3 is the registry number for (2-Nitrophenyl)urea, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(2-nitrophenyl)urea (CAS 2273-04-3) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: (2-nitrophenyl)urea. InChIKey: OEZUXIKLRGSNBT-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (2-nitrophenyl)urea |
| InChIKey | OEZUXIKLRGSNBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)