CAS 1374754-46-7 appears in our catalog under these names: N-Hydroxy-4-nitrobenzimidamide, 95%, N-Hydroxy-4-nitro-benzamidine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
N'-hydroxy-4-nitrobenzenecarboximidamide (CAS 1374754-46-7) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: N'-hydroxy-4-nitrobenzenecarboximidamide. InChIKey: SRNSBDNIAKCXGI-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | N'-hydroxy-4-nitrobenzenecarboximidamide |
| InChIKey | SRNSBDNIAKCXGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1/C(=N/O)/N)[N+](=O)[O-] |
Computed by PubChem (NCBI)