CAS 556-10-5 appears in our catalog under these names: (4-Nitrophenyl)urea, 95%, (4–Nitrophenyl)urea, (4-Nitrophenyl)urea, >98.0%(HPLC)(N), 1-(4-Nitrophenyl)urea 98%, 1-(4-Nitrophenyl)urea, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 200mg.
(4-nitrophenyl)urea (CAS 556-10-5) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: (4-nitrophenyl)urea. InChIKey: LXXTVGKSGJADFU-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (4-nitrophenyl)urea |
| InChIKey | LXXTVGKSGJADFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)