cas: 850348-88-8 — see every product listed under this CAS number, including other names
Benzoic acid,3-(1,3-dioxolan-2-ylmethoxy)-, ethyl ester, 95%, 95% (CAS 850348-88-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149EF-100mg |
| cas | 850348-88-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 1782.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-(1,3-dioxolan-2-ylmethoxy)benzoate (CAS 850348-88-8) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: ethyl 3-(1,3-dioxolan-2-ylmethoxy)benzoate. InChIKey: WHUHWYZQAUTDRM-UHFFFAOYSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | ethyl 3-(1,3-dioxolan-2-ylmethoxy)benzoate |
| InChIKey | WHUHWYZQAUTDRM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)OCC2OCCO2 |
Computed by PubChem (NCBI)