cas: 850348-88-8 — see every product listed under this CAS number, including other names
Ethyl 3-((1,3-dioxolan-2-yl)methoxy)benzoate, 95% (CAS 850348-88-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F729150-100MG |
| cas | 850348-88-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 763.29 Pln | |
| Fluorochem | 250mg | 1445.34 Pln | |
| Fluorochem | 1g | 2923.99 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 3-(1,3-dioxolan-2-ylmethoxy)benzoate (CAS 850348-88-8) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: ethyl 3-(1,3-dioxolan-2-ylmethoxy)benzoate. InChIKey: WHUHWYZQAUTDRM-UHFFFAOYSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | ethyl 3-(1,3-dioxolan-2-ylmethoxy)benzoate |
| InChIKey | WHUHWYZQAUTDRM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)OCC2OCCO2 |
Computed by PubChem (NCBI)