cas: 189439-24-5 — see every product listed under this CAS number, including other names
Benzonitrile, 2-hydroxy-4-(phenylmethoxy)-, 98%, 98% (CAS 189439-24-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113DO0-100mg |
| cas | 189439-24-5 |
| size | 100mg |
| availability | 1.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 362.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-hydroxy-4-phenylmethoxybenzonitrile (CAS 189439-24-5) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 2-hydroxy-4-phenylmethoxybenzonitrile. InChIKey: SZVJDJBGNPQFKF-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 2-hydroxy-4-phenylmethoxybenzonitrile |
| InChIKey | SZVJDJBGNPQFKF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)C#N)O |
Computed by PubChem (NCBI)