cas: 614-21-1 — see every product listed under this CAS number, including other names
Benzoylnitromethane, 98%, 98% (CAS 614-21-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114O46-250mg |
| cas | 614-21-1 |
| size | 250mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 10g | 275.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-nitro-1-phenylethanone (CAS 614-21-1) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 2-nitro-1-phenylethanone. InChIKey: JTWHVBNYYWFXSI-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-nitro-1-phenylethanone |
| InChIKey | JTWHVBNYYWFXSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C[N+](=O)[O-] |
Computed by PubChem (NCBI)