Products 614-21-1
CAS 614-21-1 appears in our catalog under these names: Benzoylnitromethane, 98%, Benzoylnitromethane, Benzoylnitromethane 98%, Benzoylnitromethane, 98%, 98%, Benzoylnitromethane, min. 95 %, 10 g. Offered by: Combi-blocks, Biosynth, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 100g, 1g, 5g, 10g, 50g, 250g, 250mg.
2-nitro-1-phenylethanone (CAS 614-21-1) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 2-nitro-1-phenylethanone. InChIKey: JTWHVBNYYWFXSI-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-nitro-1-phenylethanone |
| InChIKey | JTWHVBNYYWFXSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C[N+](=O)[O-] |
Computed by PubChem (NCBI)