cas: 374554-26-4 — see every product listed under this CAS number, including other names
Benzyl 3-aminobenzylcarbamate, 98%, 98% (CAS 374554-26-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BZPZ-250mg |
| cas | 374554-26-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 664.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-[(3-aminophenyl)methyl]carbamate (CAS 374554-26-4) is a chemical compound with the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. IUPAC name: benzyl N-[(3-aminophenyl)methyl]carbamate. InChIKey: ODFMBKSFAAEDJV-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | benzyl N-[(3-aminophenyl)methyl]carbamate |
| InChIKey | ODFMBKSFAAEDJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=CC(=CC=C2)N |
Computed by PubChem (NCBI)