CAS 114527-28-5 appears in our catalog under these names: 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine, 98%, 4–Methyl–4'–(3–carboxypropyl)–2,2'–bipyridine, 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine, 4-(4'-Methyl-[2,2'-Bipyridin]-4-Yl)Butanoic Acid, 98%, 98%, 4-(4'-Methyl-[2,2'-bipyridin]-4-yl)butanoic acid, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 10mg, 25mg, 50mg, 5g.
4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]butanoic acid (CAS 114527-28-5) is a chemical compound with the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. IUPAC name: 4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]butanoic acid. InChIKey: LFMPLEMXVCGLMX-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]butanoic acid |
| InChIKey | LFMPLEMXVCGLMX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)C2=NC=CC(=C2)CCCC(=O)O |
Computed by PubChem (NCBI)