CAS 55285-34-2 appears in our catalog under these names: 2-((4-Isopropylphenyl)amino)nicotinic acid, 2-[(4-Isopropylphenyl)amino]nicotinic acid, 95%, 2-((4-Isopropylphenyl)amino)nicotinic acid, 97%, 2-((4-Isopropylphenyl)amino)nicotinic acid 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 50mg.
2-(4-propan-2-ylanilino)pyridine-3-carboxylic acid (CAS 55285-34-2) is a chemical compound with the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. IUPAC name: 2-(4-propan-2-ylanilino)pyridine-3-carboxylic acid. InChIKey: DCLXMHUTJZKNCY-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 2-(4-propan-2-ylanilino)pyridine-3-carboxylic acid |
| InChIKey | DCLXMHUTJZKNCY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)NC2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)