Products 926204-51-5
CAS 926204-51-5 appears in our catalog under these names: 1-(4-Ethylphenyl)-1h,4h,5h,6h-cyclopenta[c]pyrazole-3-carboxylic acid, 95%, 1-(4-Ethylphenyl)-1H,4H,5H,6H-cyclopenta(c)pyrazole-3-carboxylic acid, 95%, 1-(4-Ethylphenyl)-1H,4H,5H,6H-cyclopenta(C)pyrazole-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
1-(4-ethylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid (CAS 926204-51-5) is a chemical compound with the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. IUPAC name: 1-(4-ethylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid. InChIKey: KLAZVKFCHQJCHS-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 1-(4-ethylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid |
| InChIKey | KLAZVKFCHQJCHS-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)N2C3=C(CCC3)C(=N2)C(=O)O |
Computed by PubChem (NCBI)