CAS 893612-97-0 is the registry number for 3-Amino-2-(3,5-dimethylphenylamino)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-amino-2-(3,5-dimethylanilino)benzoic acid (CAS 893612-97-0) is a chemical compound with the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. IUPAC name: 3-amino-2-(3,5-dimethylanilino)benzoic acid. InChIKey: XMZDOYVKQBUTHQ-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 3-amino-2-(3,5-dimethylanilino)benzoic acid |
| InChIKey | XMZDOYVKQBUTHQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC2=C(C=CC=C2N)C(=O)O)C |
Computed by PubChem (NCBI)