Products 893612-97-0

CAS 893612-97-0 is the registry number for 3-Amino-2-(3,5-dimethylphenylamino)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-amino-2-(3,5-dimethylanilino)benzoic acid (CAS 893612-97-0) is a chemical compound with the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. IUPAC name: 3-amino-2-(3,5-dimethylanilino)benzoic acid. InChIKey: XMZDOYVKQBUTHQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16N2O2
Molecular weight256.30 g/mol
IUPAC name3-amino-2-(3,5-dimethylanilino)benzoic acid
InChIKeyXMZDOYVKQBUTHQ-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)NC2=C(C=CC=C2N)C(=O)O)C

Computed by PubChem (NCBI)