cas: 916423-53-5 — see every product listed under this CAS number, including other names
Benzyl 3-cyano-4-oxopiperidine-1-carboxylate, 97% (CAS 916423-53-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A919119-1g |
| cas | 916423-53-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4132.24 Pln | |
| AmBeed | 250mg | 1847.23 Pln | |
| AmBeed | 10g | 12360.88 Pln | |
| AmBeed | 5g | 10225.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl 3-cyano-4-oxopiperidine-1-carboxylate (CAS 916423-53-5) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: benzyl 3-cyano-4-oxopiperidine-1-carboxylate. InChIKey: DRZBPQWPPJBSBG-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | benzyl 3-cyano-4-oxopiperidine-1-carboxylate |
| InChIKey | DRZBPQWPPJBSBG-UHFFFAOYSA-N |
| SMILES | C1CN(CC(C1=O)C#N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)