CAS 13556-81-5 appears in our catalog under these names: 3,3'-Dimethoxyazoxybenzene, 95%, 3,3'-Dimethoxyazoxybenzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
(3-methoxyphenyl)-(3-methoxyphenyl)imino-oxidoazanium (CAS 13556-81-5) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: (3-methoxyphenyl)-(3-methoxyphenyl)imino-oxidoazanium. InChIKey: DSTKJVWYCRSUJG-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (3-methoxyphenyl)-(3-methoxyphenyl)imino-oxidoazanium |
| InChIKey | DSTKJVWYCRSUJG-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)N=[N+](C2=CC(=CC=C2)OC)[O-] |
Computed by PubChem (NCBI)