CAS 885949-86-0 is the registry number for 3-(3-Oxo-1,3,4,5,6,7-hexahydro-2h-indazol-2-yl)-benzenecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(3-oxo-4,5,6,7-tetrahydro-1H-indazol-2-yl)benzoic acid (CAS 885949-86-0) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: 3-(3-oxo-4,5,6,7-tetrahydro-1H-indazol-2-yl)benzoic acid. InChIKey: BUEKHNSAMPGZHI-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 3-(3-oxo-4,5,6,7-tetrahydro-1H-indazol-2-yl)benzoic acid |
| InChIKey | BUEKHNSAMPGZHI-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)N(N2)C3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)