CAS 1166756-88-2 is the registry number for Ethyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate (CAS 1166756-88-2) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: ethyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate. InChIKey: YUKRBJVOIXTABL-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | ethyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate |
| InChIKey | YUKRBJVOIXTABL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=NOC(=N2)C3CC3 |
Computed by PubChem (NCBI)