CAS 1171456-85-1 is the registry number for 2-Acetyl-2,3,4,5-tetrahydro-1h-pyrido[4,3-b]indole-8-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-acetyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid (CAS 1171456-85-1) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: 2-acetyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid. InChIKey: ZUDJMYATTQUBHD-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 2-acetyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
| InChIKey | ZUDJMYATTQUBHD-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C(C1)C3=C(N2)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)