cas: 287953-54-2 — see every product listed under this CAS number, including other names
Benzyl 4-(chlorosulfonyl)piperidine-1-carboxylate, 95% (CAS 287953-54-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091897-250MG |
| cas | 287953-54-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 2.5g | 534.20 Pln | |
| Fluorochem | 5g | 1008.00 Pln | |
| Fluorochem | 10g | 1955.58 Pln | |
| Fluorochem | 25g | 4006.94 Pln | |
| Fluorochem | 100g | 12753.86 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl 4-chlorosulfonylpiperidine-1-carboxylate (CAS 287953-54-2) is a chemical compound with the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. IUPAC name: benzyl 4-chlorosulfonylpiperidine-1-carboxylate. InChIKey: HEGCWAOVTPVFBJ-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4S |
|---|---|
| Molecular weight | 317.79 g/mol |
| IUPAC name | benzyl 4-chlorosulfonylpiperidine-1-carboxylate |
| InChIKey | HEGCWAOVTPVFBJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1S(=O)(=O)Cl)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)