cas: 56414-76-7 — see every product listed under this CAS number, including other names
Benzyl N-(2-(morpholin-4-yl)-2-oxoethyl)carbamate, 90% (CAS 56414-76-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A909299-10g |
| cas | 56414-76-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6417.25 Pln | |
| AmBeed | 25g | 12764.50 Pln |
| purity | 90% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl N-(2-morpholin-4-yl-2-oxoethyl)carbamate (CAS 56414-76-7) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: benzyl N-(2-morpholin-4-yl-2-oxoethyl)carbamate. InChIKey: GBSPBRGWMGSOAG-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | benzyl N-(2-morpholin-4-yl-2-oxoethyl)carbamate |
| InChIKey | GBSPBRGWMGSOAG-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)CNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)