cas: 25316-59-0 — see every product listed under this CAS number, including other names
Benzyltributylammonium Bromide, 98%, 98% (CAS 25316-59-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114O68-25g |
| cas | 25316-59-0 |
| size | 25g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 83.60 Pln | |
| Chemat | 500g | 235.20 Pln | |
| Chemat | 1kg | 381.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl(tributyl)azanium (CAS 25316-59-0) is a chemical compound with the molecular formula C19H34N+ and a molecular weight of 276.5 g/mol. IUPAC name: benzyl(tributyl)azanium. InChIKey: QSRFYFHZPSGRQX-UHFFFAOYSA-N.
| Molecular formula | C19H34N+ |
|---|---|
| Molecular weight | 276.5 g/mol |
| IUPAC name | benzyl(tributyl)azanium |
| InChIKey | QSRFYFHZPSGRQX-UHFFFAOYSA-N |
| SMILES | CCCC[N+](CCCC)(CCCC)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)