Products 3818-50-6
CAS 3818-50-6 appears in our catalog under these names: Bephenium Hydroxynaphthoate, Bephenium Hydroxynaphthoate, Bephenium (hydroxynaphthoate)/ 100%, Bephenium (hydroxynaphthoate) 98+%, Bephenium (hydroxynaphthoate), 98+%, 98+%. Offered by: GLPBio, Mikromol, LoGiCal, TargetMol, Ambeed. Available pack sizes: 50mg, 100mg, 10mg, 1g, 200mg, 500mg, 10mM (in 1ml dmso), 5g.
Benzyl-dimethyl-(2-phenoxyethyl)azanium;3-carboxynaphthalen-2-olate (CAS 3818-50-6) is a chemical compound with the molecular formula C28H29NO4 and a molecular weight of 443.5 g/mol. IUPAC name: benzyl-dimethyl-(2-phenoxyethyl)azanium;3-carboxynaphthalen-2-olate. InChIKey: PMPQCPQAHTXCDK-UHFFFAOYSA-M.
| Molecular formula | C28H29NO4 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | benzyl-dimethyl-(2-phenoxyethyl)azanium;3-carboxynaphthalen-2-olate |
| InChIKey | PMPQCPQAHTXCDK-UHFFFAOYSA-M |
| SMILES | C[N+](C)(CCOC1=CC=CC=C1)CC2=CC=CC=C2.C1=CC=C2C=C(C(=CC2=C1)C(=O)O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
BEPHENIUM HYDROXYNAPHTHOATE, Naphthammonum, Alcopar, Alcopara, Befeniol, Debefenium, Frantin, Lecibis, Naftamon, Naphtamon