cas: 135908-43-9 — see every product listed under this CAS number, including other names
Bicyclo[2.2.2]octane-1-carboxylic acid, 4-amino-, methyl ester, hydrochloride (1:1), 97%, 97% (CAS 135908-43-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1191DV-100mg |
| cas | 135908-43-9 |
| size | 100mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 500mg | 270.80 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1029.20 Pln | |
| Chemat | 10g | 1715.60 Pln | |
| Chemat | 25g | 3784.40 Pln | |
| Chemat | 50g | 6405.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-aminobicyclo[2.2.2]octane-1-carboxylate;hydrochloride (CAS 135908-43-9) is a chemical compound with the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. IUPAC name: methyl 4-aminobicyclo[2.2.2]octane-1-carboxylate;hydrochloride. InChIKey: PLYVYQNMLHQMCW-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO2 |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | methyl 4-aminobicyclo[2.2.2]octane-1-carboxylate;hydrochloride |
| InChIKey | PLYVYQNMLHQMCW-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCC(CC1)(CC2)N.Cl |
Computed by PubChem (NCBI)