Products 16100-92-8
CAS 16100-92-8 is the registry number for (1R,9Ar)-octahydro-2h-quinolizine-1-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxylic acid;hydrochloride (CAS 16100-92-8) is a chemical compound with the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. IUPAC name: (1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxylic acid;hydrochloride. InChIKey: QFMWAHYNWNFAGF-VTLYIQCISA-N.
| Molecular formula | C10H18ClNO2 |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | (1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxylic acid;hydrochloride |
| InChIKey | QFMWAHYNWNFAGF-VTLYIQCISA-N |
| SMILES | C1CCN2CCC[C@H]([C@H]2C1)C(=O)O.Cl |
Computed by PubChem (NCBI)