CAS 1390654-27-9 is the registry number for 1-(1-Pyrrolidinyl)cyclopentanecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
1-pyrrolidin-1-ylcyclopentane-1-carboxylic acid;hydrochloride (CAS 1390654-27-9) is a chemical compound with the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. IUPAC name: 1-pyrrolidin-1-ylcyclopentane-1-carboxylic acid;hydrochloride. InChIKey: AYFUVYIBDZYQJA-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO2 |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 1-pyrrolidin-1-ylcyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | AYFUVYIBDZYQJA-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C(=O)O)N2CCCC2.Cl |
Computed by PubChem (NCBI)