Products 1390654-27-9

CAS 1390654-27-9 is the registry number for 1-(1-Pyrrolidinyl)cyclopentanecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-pyrrolidin-1-ylcyclopentane-1-carboxylic acid;hydrochloride (CAS 1390654-27-9) is a chemical compound with the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. IUPAC name: 1-pyrrolidin-1-ylcyclopentane-1-carboxylic acid;hydrochloride. InChIKey: AYFUVYIBDZYQJA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18ClNO2
Molecular weight219.71 g/mol
IUPAC name1-pyrrolidin-1-ylcyclopentane-1-carboxylic acid;hydrochloride
InChIKeyAYFUVYIBDZYQJA-UHFFFAOYSA-N
SMILESC1CCC(C1)(C(=O)O)N2CCCC2.Cl

Computed by PubChem (NCBI)