CAS 253136-28-6 appears in our catalog under these names: Decahydroquinoline-2-carboxylic acid hydrochloride, 97%, Decahydroquinoline-2-carboxylic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g.
1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxylic acid;hydrochloride (CAS 253136-28-6) is a chemical compound with the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. IUPAC name: 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxylic acid;hydrochloride. InChIKey: KCJYFBPJZSHASC-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO2 |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxylic acid;hydrochloride |
| InChIKey | KCJYFBPJZSHASC-UHFFFAOYSA-N |
| SMILES | C1CCC2C(C1)CCC(N2)C(=O)O.Cl |
Computed by PubChem (NCBI)