Products 2204587-97-1
CAS 2204587-97-1 is the registry number for 1-(Piperidin-1-ylmethyl)cyclopropane-1-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(piperidin-1-ylmethyl)cyclopropane-1-carboxylic acid;hydrochloride (CAS 2204587-97-1) is a chemical compound with the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. IUPAC name: 1-(piperidin-1-ylmethyl)cyclopropane-1-carboxylic acid;hydrochloride. InChIKey: VQSUFSTWRLKYTR-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO2 |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 1-(piperidin-1-ylmethyl)cyclopropane-1-carboxylic acid;hydrochloride |
| InChIKey | VQSUFSTWRLKYTR-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2(CC2)C(=O)O.Cl |
Computed by PubChem (NCBI)