CAS 700877-55-0 appears in our catalog under these names: Bidenoside C/ 98.78% (existing batch purity), Bidenoside C, Bidenoside C. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 1 mg.
(2R,3R,4S,5S,6R)-2-[(Z)-dec-8-en-4,6-diynoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 700877-55-0) is a chemical compound with the molecular formula C16H22O6 and a molecular weight of 310.34 g/mol. IUPAC name: (2R,3R,4S,5S,6R)-2-[(Z)-dec-8-en-4,6-diynoxy]-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: QIFYDSMWESCVBZ-JNDSXIQISA-N.
| Molecular formula | C16H22O6 |
|---|---|
| Molecular weight | 310.34 g/mol |
| IUPAC name | (2R,3R,4S,5S,6R)-2-[(Z)-dec-8-en-4,6-diynoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | QIFYDSMWESCVBZ-JNDSXIQISA-N |
| SMILES | C/C=C\C#CC#CCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)