CAS 188011-69-0 appears in our catalog under these names: Bikinin/ 100%, Bikinin, Bikinin, >98.0%(HPLC)(T), 4-((5-Bromopyridin-2-yl)amino)-4-oxobutanoic acid, Bikinin 98%. Offered by: TargetMol, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 10mM (in 1ml dmso), 250mg.
4-[(5-bromo-2-pyridinyl)amino]-4-oxobutanoic acid (CAS 188011-69-0) is a chemical compound with the molecular formula C9H9BrN2O3 and a molecular weight of 273.08 g/mol. IUPAC name: 4-[(5-bromo-2-pyridinyl)amino]-4-oxobutanoic acid. InChIKey: XFYYQDHEDOXWGA-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O3 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | 4-[(5-bromo-2-pyridinyl)amino]-4-oxobutanoic acid |
| InChIKey | XFYYQDHEDOXWGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)