cas: 7094-34-0 — see every product listed under this CAS number, including other names
Bis(3-chlorophenyl)methanone 95% (CAS 7094-34-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A316158-250mg |
| cas | 7094-34-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 631.81 Pln | |
| Ambeed | 5g | 1410.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A316158 |
Bis(3-chlorophenyl)methanone (CAS 7094-34-0) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: bis(3-chlorophenyl)methanone. InChIKey: JSNQEKVWLZDWEG-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | bis(3-chlorophenyl)methanone |
| InChIKey | JSNQEKVWLZDWEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)