cas: 7094-34-0 — see every product listed under this CAS number, including other names
3,3'-Dichlorobenzophenone, 97% (CAS 7094-34-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F022824-250MG |
| cas | 7094-34-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 1403.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Bis(3-chlorophenyl)methanone (CAS 7094-34-0) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: bis(3-chlorophenyl)methanone. InChIKey: JSNQEKVWLZDWEG-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | bis(3-chlorophenyl)methanone |
| InChIKey | JSNQEKVWLZDWEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)