Bis(3-nitrophenyl)methanone, 97%
cas: 21222-05-9 — see every product listed under this CAS number, including other names
Bis(3-nitrophenyl)methanone, 97% (CAS 21222-05-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A799232-250mg |
| cas | 21222-05-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 364.81 Pln | |
| Ambeed | 25g | 1138.00 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 362.00 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 164.41 Pln | |
| BLDpharm | 5g | 392.11 Pln | |
| BLDpharm | 25g | 1225.15 Pln | |
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 362.39 Pln | |
| Fluorochem | 25g | 1169.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Bis(3-nitrophenyl)methanone (CAS 21222-05-9) is a chemical compound with the molecular formula C13H8N2O5 and a molecular weight of 272.21 g/mol. IUPAC name: bis(3-nitrophenyl)methanone. InChIKey: BSDKBWGNIJMCID-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O5 |
|---|---|
| Molecular weight | 272.21 g/mol |
| IUPAC name | bis(3-nitrophenyl)methanone |
| InChIKey | BSDKBWGNIJMCID-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)