CAS 330466-17-6 is the registry number for 2-(5-Methylisoxazol-3-yl)-1,3-dioxoisoindoline-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-methyl-1,2-oxazol-3-yl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 330466-17-6) is a chemical compound with the molecular formula C13H8N2O5 and a molecular weight of 272.21 g/mol. IUPAC name: 2-(5-methyl-1,2-oxazol-3-yl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: SWQOBFVJSZGOHL-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O5 |
|---|---|
| Molecular weight | 272.21 g/mol |
| IUPAC name | 2-(5-methyl-1,2-oxazol-3-yl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | SWQOBFVJSZGOHL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)