CAS 1469-74-5 appears in our catalog under these names: 3,4'–Dinitrobenzophenone, 3,4'-Dinitrobenzophenone, >98.0%(GC), 3,4-Dinitrobenzophenone, 97%, 97%, (3-Nitrophenyl)(4-nitrophenyl)methanone, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 10g.
(3-nitrophenyl)-(4-nitrophenyl)methanone (CAS 1469-74-5) is a chemical compound with the molecular formula C13H8N2O5 and a molecular weight of 272.21 g/mol. IUPAC name: (3-nitrophenyl)-(4-nitrophenyl)methanone. InChIKey: ZEGCOKXUTZGBGN-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O5 |
|---|---|
| Molecular weight | 272.21 g/mol |
| IUPAC name | (3-nitrophenyl)-(4-nitrophenyl)methanone |
| InChIKey | ZEGCOKXUTZGBGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)