CAS 667446-41-5 is the registry number for 2-(2-Furylmethyl)-4-nitro-1h-isoindole-1,3(2h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(furan-2-ylmethyl)-4-nitroisoindole-1,3-dione (CAS 667446-41-5) is a chemical compound with the molecular formula C13H8N2O5 and a molecular weight of 272.21 g/mol. IUPAC name: 2-(furan-2-ylmethyl)-4-nitroisoindole-1,3-dione. InChIKey: INAULTGLYURLBW-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O5 |
|---|---|
| Molecular weight | 272.21 g/mol |
| IUPAC name | 2-(furan-2-ylmethyl)-4-nitroisoindole-1,3-dione |
| InChIKey | INAULTGLYURLBW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)N(C2=O)CC3=CC=CO3 |
Computed by PubChem (NCBI)