CAS 867340-26-9 appears in our catalog under these names: 2-((1,3-Dioxoisoindolin-2-yl)methyl)oxazole-4-carboxylic acid, 95%, 2-((1,3-Dioxoisoindolin-2-yl)methyl)oxazole-4-carboxylic acid, 98%, 2-((1,3-Dioxoisoindolin-2-yl)methyl)oxazole-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-oxazole-4-carboxylic acid (CAS 867340-26-9) is a chemical compound with the molecular formula C13H8N2O5 and a molecular weight of 272.21 g/mol. IUPAC name: 2-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-oxazole-4-carboxylic acid. InChIKey: LIRMFTICAFPKPC-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O5 |
|---|---|
| Molecular weight | 272.21 g/mol |
| IUPAC name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-oxazole-4-carboxylic acid |
| InChIKey | LIRMFTICAFPKPC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=NC(=CO3)C(=O)O |
Computed by PubChem (NCBI)