cas: 16926-73-1 — see every product listed under this CAS number, including other names
Bis(4-aminophenyl) Terephthalate, >98.0%(HPLC) (CAS 16926-73-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4541-5G |
| cas | 16926-73-1 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 280.61 Pln | |
| TCI | 25g | 944.44 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
Bis(4-aminophenyl) benzene-1,4-dicarboxylate (CAS 16926-73-1) is a chemical compound with the molecular formula C20H16N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: bis(4-aminophenyl) benzene-1,4-dicarboxylate. InChIKey: CFTXGNJIXHFHTH-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | bis(4-aminophenyl) benzene-1,4-dicarboxylate |
| InChIKey | CFTXGNJIXHFHTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC2=CC=C(C=C2)N)C(=O)OC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)