cas: 16926-73-1 — see every product listed under this CAS number, including other names
Bis(4-aminophenyl) terephthalate, 97% (CAS 16926-73-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F226892-100MG |
| cas | 16926-73-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 237.43 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Bis(4-aminophenyl) benzene-1,4-dicarboxylate (CAS 16926-73-1) is a chemical compound with the molecular formula C20H16N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: bis(4-aminophenyl) benzene-1,4-dicarboxylate. InChIKey: CFTXGNJIXHFHTH-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | bis(4-aminophenyl) benzene-1,4-dicarboxylate |
| InChIKey | CFTXGNJIXHFHTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC2=CC=C(C=C2)N)C(=O)OC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)