Bis(4-methylbenzyl) oxalate, 97%
cas: 18241-31-1 — see every product listed under this CAS number, including other names
Bis(4-methylbenzyl) oxalate, 97% (CAS 18241-31-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A443059-5g |
| cas | 18241-31-1 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 25g | 131.19 Pln | |
| Ambeed | 100g | 259.12 Pln | |
| Ambeed | 500g | 765.31 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 25g | 136.64 Pln | |
| BLDpharm | 100g | 275.48 Pln | |
| BLDpharm | 500g | 819.74 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 25g | 206.20 Pln | |
| Fluorochem | 100g | 549.82 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Bis[(4-methylphenyl)methyl] oxalate (CAS 18241-31-1) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: bis[(4-methylphenyl)methyl] oxalate. InChIKey: FPFZBTUMXCSRLU-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | bis[(4-methylphenyl)methyl] oxalate |
| InChIKey | FPFZBTUMXCSRLU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)COC(=O)C(=O)OCC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)
Synonyms:
Bis(4-methylbenzyl) oxalate, Ethanedioic acid, 1,2-bis[(4-methylphenyl)methyl] ester, Ethanedioic acid, bis[(4-methylphenyl)methyl] ester, Ethanedioic acid, bis((4-methylphenyl)methyl) ester, Ethanedioic acid, 1,2-bis((4-methylphenyl)methyl) ester, bis[(4-methylphenyl)methyl] oxalate, Bis(p-methylbenzyl)oxalate, di(p-methylbenzyl)oxalat, bis(p-tolylmethyl) oxalate, FPFZBTUMXCSRLU-UHFFFAOYSA-N