cas: 1443981-41-6 — see every product listed under this CAS number, including other names
Bis(6-methyl-1,2-dihydropyridin-2-one), sulfuric acid, 95% (CAS 1443981-41-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1033966-1g |
| cas | 1443981-41-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 200.20 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Bis(6-methyl-1H-pyridin-2-one);sulfuric acid (CAS 1443981-41-6) is a chemical compound with the molecular formula C12H16N2O6S and a molecular weight of 316.33 g/mol. IUPAC name: bis(6-methyl-1H-pyridin-2-one);sulfuric acid. InChIKey: XNEIWYITXOCSKQ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O6S |
|---|---|
| Molecular weight | 316.33 g/mol |
| IUPAC name | bis(6-methyl-1H-pyridin-2-one);sulfuric acid |
| InChIKey | XNEIWYITXOCSKQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC(=O)N1.CC1=CC=CC(=O)N1.OS(=O)(=O)O |
Computed by PubChem (NCBI)