Products 214633-68-8
CAS 214633-68-8 is the registry number for H-L-Cys(oNv)-OH. Offered by: Iris Biotech. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g.
(2R)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methylsulfanyl]propanoic acid (CAS 214633-68-8) is a chemical compound with the molecular formula C12H16N2O6S and a molecular weight of 316.33 g/mol. IUPAC name: (2R)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methylsulfanyl]propanoic acid. InChIKey: BWYOFVMTWBOZOW-QMMMGPOBSA-N.
| Molecular formula | C12H16N2O6S |
|---|---|
| Molecular weight | 316.33 g/mol |
| IUPAC name | (2R)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methylsulfanyl]propanoic acid |
| InChIKey | BWYOFVMTWBOZOW-QMMMGPOBSA-N |
| SMILES | COC1=C(C=C(C(=C1)CSC[C@@H](C(=O)O)N)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)